C14H16ClFN2O3S — CID 137342865
(3R,8aR)-2-(3-chloro-4-fluorophenyl)sulfonyl-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one (PubChem CID 137342865) has the molecular formula C14H16ClFN2O3S and a molecular weight of 346.81 g/mol. Its IUPAC name is (3R,8aR)-2-(3-chloro-4-fluorophenyl)sulfonyl-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one.
| Compound Name | (3R,8aR)-2-(3-chloro-4-fluorophenyl)sulfonyl-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 137342865 |
| Molecular Formula | C14H16ClFN2O3S |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | (3R,8aR)-2-(3-chloro-4-fluorophenyl)sulfonyl-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
| SMILES | C[C@@H]1C(=O)N2CCC[C@@H]2CN1S(=O)(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H16ClFN2O3S/c1-9-14(19)17-6-2-3-10(17)8-18(9)22(20,21)11-4-5-13(16)12(15)7-11/h4-5,7,9-10H,2-3,6,8H2,1H3/t9-,10-/m1/s1 |
| InChIKey | ALFQEJQATAKZGF-NXEZZACHSA-N |
| XLogP | 1.86 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |