C15H19FN2O3S — CID 137340027
(3R,8aS)-2-(2-fluoro-5-methylphenyl)sulfonyl-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one (PubChem CID 137340027) has the molecular formula C15H19FN2O3S and a molecular weight of 326.39 g/mol. Its IUPAC name is (3R,8aS)-2-(2-fluoro-5-methylphenyl)sulfonyl-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one.
| Compound Name | (3R,8aS)-2-(2-fluoro-5-methylphenyl)sulfonyl-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 137340027 |
| Molecular Formula | C15H19FN2O3S |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | (3R,8aS)-2-(2-fluoro-5-methylphenyl)sulfonyl-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
| SMILES | Cc1ccc(F)c(S(=O)(=O)N2C[C@@H]3CCCN3C(=O)[C@H]2C)c1 |
| InChI | InChI=1S/C15H19FN2O3S/c1-10-5-6-13(16)14(8-10)22(20,21)18-9-12-4-3-7-17(12)15(19)11(18)2/h5-6,8,11-12H,3-4,7,9H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | YPBCEUQCXOWOCF-NEPJUHHUSA-N |
| XLogP | 1.52 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |