C14H20N2O3S2 — CID 137341741
(3R,8aR)-2-(2,5-dimethylthiophen-3-yl)sulfonyl-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one (PubChem CID 137341741) has the molecular formula C14H20N2O3S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is (3R,8aR)-2-(2,5-dimethylthiophen-3-yl)sulfonyl-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one.
| Compound Name | (3R,8aR)-2-(2,5-dimethylthiophen-3-yl)sulfonyl-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
|---|---|
| PubChem CID | 137341741 |
| Molecular Formula | C14H20N2O3S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (3R,8aR)-2-(2,5-dimethylthiophen-3-yl)sulfonyl-3-methyl-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-4-one |
| SMILES | Cc1cc(S(=O)(=O)N2C[C@H]3CCCN3C(=O)[C@H]2C)c(C)s1 |
| InChI | InChI=1S/C14H20N2O3S2/c1-9-7-13(11(3)20-9)21(18,19)16-8-12-5-4-6-15(12)14(17)10(16)2/h7,10,12H,4-6,8H2,1-3H3/t10-,12-/m1/s1 |
| InChIKey | IRFQVHFWHONGKV-ZYHUDNBSSA-N |
| XLogP | 1.75 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |