C21H29NO3S — CID 177441169
(E)-3-[(2Z)-2-heptylidene-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]prop-2-enal (PubChem CID 177441169) has the molecular formula C21H29NO3S and a molecular weight of 375.53 g/mol. Its IUPAC name is (E)-3-[(2Z)-2-heptylidene-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]prop-2-enal.
| Compound Name | (E)-3-[(2Z)-2-heptylidene-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]prop-2-enal |
|---|---|
| PubChem CID | 177441169 |
| Molecular Formula | C21H29NO3S |
| Molecular Weight | 375.53 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | (E)-3-[(2Z)-2-heptylidene-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl]prop-2-enal |
| SMILES | CCCCCC/C=C1/C(/C=C/C=O)CCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H29NO3S/c1-3-4-5-6-7-10-21-19(9-8-17-23)15-16-22(21)26(24,25)20-13-11-18(2)12-14-20/h8-14,17,19H,3-7,15-16H2,1-2H3/b9-8+,21-10- |
| InChIKey | XUUULTOEFHHQDT-VSWATVGFSA-N |
| XLogP | 4.62 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|