C21H31NO2S — CID 134933788
(4E)-4-heptylidene-5-methyl-1-(4-methylphenyl)sulfonyl-3,5-dihydro-2H-azepine (PubChem CID 134933788) has the molecular formula C21H31NO2S and a molecular weight of 361.55 g/mol. Its IUPAC name is (4E)-4-heptylidene-5-methyl-1-(4-methylphenyl)sulfonyl-3,5-dihydro-2H-azepine.
| Compound Name | (4E)-4-heptylidene-5-methyl-1-(4-methylphenyl)sulfonyl-3,5-dihydro-2H-azepine |
|---|---|
| PubChem CID | 134933788 |
| Molecular Formula | C21H31NO2S |
| Molecular Weight | 361.55 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | (4E)-4-heptylidene-5-methyl-1-(4-methylphenyl)sulfonyl-3,5-dihydro-2H-azepine |
| SMILES | CCCCCC/C=C1\CCN(S(=O)(=O)c2ccc(C)cc2)C=CC1C |
| InChI | InChI=1S/C21H31NO2S/c1-4-5-6-7-8-9-20-15-17-22(16-14-19(20)3)25(23,24)21-12-10-18(2)11-13-21/h9-14,16,19H,4-8,15,17H2,1-3H3/b20-9+ |
| InChIKey | VAUICFYCTYMANU-AWQFTUOYSA-N |
| XLogP | 5.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.55 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|