C27H30N2O4S — CID 11155839
(3aR,4R,8aR,8bS)-4-butyl-7-(4-methylphenyl)sulfonyl-2-phenyl-3a,4,6,8,8a,8b-hexahydropyrrolo[3,4-e]isoindole-1,3-dione (PubChem CID 11155839) has the molecular formula C27H30N2O4S and a molecular weight of 478.61 g/mol. Its IUPAC name is (3aR,4R,8aR,8bS)-4-butyl-7-(4-methylphenyl)sulfonyl-2-phenyl-3a,4,6,8,8a,8b-hexahydropyrrolo[3,4-e]isoindole-1,3-dione.
| Compound Name | (3aR,4R,8aR,8bS)-4-butyl-7-(4-methylphenyl)sulfonyl-2-phenyl-3a,4,6,8,8a,8b-hexahydropyrrolo[3,4-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11155839 |
| Molecular Formula | C27H30N2O4S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | (3aR,4R,8aR,8bS)-4-butyl-7-(4-methylphenyl)sulfonyl-2-phenyl-3a,4,6,8,8a,8b-hexahydropyrrolo[3,4-e]isoindole-1,3-dione |
| SMILES | CCCC[C@@H]1C=C2CN(S(=O)(=O)c3ccc(C)cc3)C[C@@H]2[C@@H]2C(=O)N(c3ccccc3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C27H30N2O4S/c1-3-4-8-19-15-20-16-28(34(32,33)22-13-11-18(2)12-14-22)17-23(20)25-24(19)26(30)29(27(25)31)21-9-6-5-7-10-21/h5-7,9-15,19,23-25H,3-4,8,16-17H2,1-2H3/t19-,23+,24-,25+/m1/s1 |
| InChIKey | HEOYWQROGMDWCY-MNVNNWCQSA-N |
| XLogP | 4.17 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|