C29H35NO3S — CID 102441347
5-butyl-8-cyclopropyl-2-(4-methylphenyl)sulfonyl-6-phenyl-1,3,4,6,8,8a-hexahydrocyclopenta[c]azepin-7-one (PubChem CID 102441347) has the molecular formula C29H35NO3S and a molecular weight of 477.67 g/mol. Its IUPAC name is 5-butyl-8-cyclopropyl-2-(4-methylphenyl)sulfonyl-6-phenyl-1,3,4,6,8,8a-hexahydrocyclopenta[c]azepin-7-one.
| Compound Name | 5-butyl-8-cyclopropyl-2-(4-methylphenyl)sulfonyl-6-phenyl-1,3,4,6,8,8a-hexahydrocyclopenta[c]azepin-7-one |
|---|---|
| PubChem CID | 102441347 |
| Molecular Formula | C29H35NO3S |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 5-butyl-8-cyclopropyl-2-(4-methylphenyl)sulfonyl-6-phenyl-1,3,4,6,8,8a-hexahydrocyclopenta[c]azepin-7-one |
| SMILES | CCCCC1=C2C(c3ccccc3)C(=O)C(C3CC3)C2CN(S(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C29H35NO3S/c1-3-4-8-22-17-18-30(34(32,33)24-15-11-20(2)12-16-24)19-25-26(22)28(21-9-6-5-7-10-21)29(31)27(25)23-13-14-23/h5-7,9-12,15-16,23,25,27-28H,3-4,8,13-14,17-19H2,1-2H3 |
| InChIKey | AZJOHDNMBFNIJS-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|