C29H33NO3S2Si — CID 102441336
5-[dimethyl(phenyl)silyl]-6-methyl-2-(4-methylphenyl)sulfonyl-8-thiophen-2-yl-1,3,4,6,8,8a-hexahydrocyclopenta[c]azepin-7-one (PubChem CID 102441336) has the molecular formula C29H33NO3S2Si and a molecular weight of 535.81 g/mol. Its IUPAC name is 5-[dimethyl(phenyl)silyl]-6-methyl-2-(4-methylphenyl)sulfonyl-8-thiophen-2-yl-1,3,4,6,8,8a-hexahydrocyclopenta[c]azepin-7-one.
| Compound Name | 5-[dimethyl(phenyl)silyl]-6-methyl-2-(4-methylphenyl)sulfonyl-8-thiophen-2-yl-1,3,4,6,8,8a-hexahydrocyclopenta[c]azepin-7-one |
|---|---|
| PubChem CID | 102441336 |
| Molecular Formula | C29H33NO3S2Si |
| Molecular Weight | 535.81 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | 5-[dimethyl(phenyl)silyl]-6-methyl-2-(4-methylphenyl)sulfonyl-8-thiophen-2-yl-1,3,4,6,8,8a-hexahydrocyclopenta[c]azepin-7-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC([Si](C)(C)c3ccccc3)=C3C(C)C(=O)C(c4cccs4)C3C2)cc1 |
| InChI | InChI=1S/C29H33NO3S2Si/c1-20-12-14-22(15-13-20)35(32,33)30-17-16-26(36(3,4)23-9-6-5-7-10-23)27-21(2)29(31)28(24(27)19-30)25-11-8-18-34-25/h5-15,18,21,24,28H,16-17,19H2,1-4H3 |
| InChIKey | GIASFHJYFFDFOV-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.81 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|