C16H22INO5S — CID 122678245
methyl 2-[3-[(S)-hydroxy(iodo)methyl]-1-(4-methylphenyl)sulfonylpiperidin-4-yl]acetate (PubChem CID 122678245) has the molecular formula C16H22INO5S and a molecular weight of 467.33 g/mol. Its IUPAC name is methyl 2-[3-[(S)-hydroxy(iodo)methyl]-1-(4-methylphenyl)sulfonylpiperidin-4-yl]acetate.
| Compound Name | methyl 2-[3-[(S)-hydroxy(iodo)methyl]-1-(4-methylphenyl)sulfonylpiperidin-4-yl]acetate |
|---|---|
| PubChem CID | 122678245 |
| Molecular Formula | C16H22INO5S |
| Molecular Weight | 467.33 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | methyl 2-[3-[(S)-hydroxy(iodo)methyl]-1-(4-methylphenyl)sulfonylpiperidin-4-yl]acetate |
| SMILES | COC(=O)CC1CCN(S(=O)(=O)c2ccc(C)cc2)CC1[C@@H](O)I |
| InChI | InChI=1S/C16H22INO5S/c1-11-3-5-13(6-4-11)24(21,22)18-8-7-12(9-15(19)23-2)14(10-18)16(17)20/h3-6,12,14,16,20H,7-10H2,1-2H3/t12?,14?,16-/m1/s1 |
| InChIKey | JEXVOWUDDZRFTE-LDZOIKDWSA-N |
| XLogP | 1.94 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|