C17H10Br2N2OS — CID 19656675
4-(4-bromo-5-methylthiophen-2-yl)-6-(4-bromophenyl)-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 19656675) has the molecular formula C17H10Br2N2OS and a molecular weight of 450.16 g/mol. Its IUPAC name is 4-(4-bromo-5-methylthiophen-2-yl)-6-(4-bromophenyl)-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 4-(4-bromo-5-methylthiophen-2-yl)-6-(4-bromophenyl)-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19656675 |
| Molecular Formula | C17H10Br2N2OS |
| Molecular Weight | 450.16 g/mol |
| Exact Mass | 447.89 |
| IUPAC Name | 4-(4-bromo-5-methylthiophen-2-yl)-6-(4-bromophenyl)-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | Cc1sc(-c2cc(-c3ccc(Br)cc3)[nH]c(=O)c2C#N)cc1Br |
| InChI | InChI=1S/C17H10Br2N2OS/c1-9-14(19)7-16(23-9)12-6-15(21-17(22)13(12)8-20)10-2-4-11(18)5-3-10/h2-7H,1H3,(H,21,22) |
| InChIKey | AYUDELPHURZWAT-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.16 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |