C17H10BrN3O3S — CID 19656686
4-(4-bromo-5-methylthiophen-2-yl)-6-(4-nitrophenyl)-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 19656686) has the molecular formula C17H10BrN3O3S and a molecular weight of 416.26 g/mol. Its IUPAC name is 4-(4-bromo-5-methylthiophen-2-yl)-6-(4-nitrophenyl)-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 4-(4-bromo-5-methylthiophen-2-yl)-6-(4-nitrophenyl)-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19656686 |
| Molecular Formula | C17H10BrN3O3S |
| Molecular Weight | 416.26 g/mol |
| Exact Mass | 414.96 |
| IUPAC Name | 4-(4-bromo-5-methylthiophen-2-yl)-6-(4-nitrophenyl)-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | Cc1sc(-c2cc(-c3ccc([N+](=O)[O-])cc3)[nH]c(=O)c2C#N)cc1Br |
| InChI | InChI=1S/C17H10BrN3O3S/c1-9-14(18)7-16(25-9)12-6-15(20-17(22)13(12)8-19)10-2-4-11(5-3-10)21(23)24/h2-7H,1H3,(H,20,22) |
| InChIKey | DCRVDODCNSRUCG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 99.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.26 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|