C25H17N5O4 — CID 177377171
1-[4-[5-cyano-4-(4-nitrophenyl)-6-oxo-1H-pyridin-2-yl]phenyl]-3-phenylurea (PubChem CID 177377171) has the molecular formula C25H17N5O4 and a molecular weight of 451.44 g/mol. Its IUPAC name is 1-[4-[5-cyano-4-(4-nitrophenyl)-6-oxo-1H-pyridin-2-yl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[5-cyano-4-(4-nitrophenyl)-6-oxo-1H-pyridin-2-yl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 177377171 |
| Molecular Formula | C25H17N5O4 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 1-[4-[5-cyano-4-(4-nitrophenyl)-6-oxo-1H-pyridin-2-yl]phenyl]-3-phenylurea |
| SMILES | N#Cc1c(-c2ccc([N+](=O)[O-])cc2)cc(-c2ccc(NC(=O)Nc3ccccc3)cc2)[nH]c1=O |
| InChI | InChI=1S/C25H17N5O4/c26-15-22-21(16-8-12-20(13-9-16)30(33)34)14-23(29-24(22)31)17-6-10-19(11-7-17)28-25(32)27-18-4-2-1-3-5-18/h1-14H,(H,29,31)(H2,27,28,32) |
| InChIKey | NWDBTPCKVPWWCM-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 140.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|