C21H17N3O6 — CID 19656837
6-(4-nitrophenyl)-2-oxo-4-(3,4,5-trimethoxyphenyl)-1H-pyridine-3-carbonitrile (PubChem CID 19656837) has the molecular formula C21H17N3O6 and a molecular weight of 407.38 g/mol. Its IUPAC name is 6-(4-nitrophenyl)-2-oxo-4-(3,4,5-trimethoxyphenyl)-1H-pyridine-3-carbonitrile.
| Compound Name | 6-(4-nitrophenyl)-2-oxo-4-(3,4,5-trimethoxyphenyl)-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19656837 |
| Molecular Formula | C21H17N3O6 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 6-(4-nitrophenyl)-2-oxo-4-(3,4,5-trimethoxyphenyl)-1H-pyridine-3-carbonitrile |
| SMILES | COc1cc(-c2cc(-c3ccc([N+](=O)[O-])cc3)[nH]c(=O)c2C#N)cc(OC)c1OC |
| InChI | InChI=1S/C21H17N3O6/c1-28-18-8-13(9-19(29-2)20(18)30-3)15-10-17(23-21(25)16(15)11-22)12-4-6-14(7-5-12)24(26)27/h4-10H,1-3H3,(H,23,25) |
| InChIKey | NYXWLWXRCANTAX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 127.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|