C18H13N3O6 — CID 19657141
6-(3,4-dimethoxyphenyl)-4-(5-nitrofuran-2-yl)-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 19657141) has the molecular formula C18H13N3O6 and a molecular weight of 367.32 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-4-(5-nitrofuran-2-yl)-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 6-(3,4-dimethoxyphenyl)-4-(5-nitrofuran-2-yl)-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19657141 |
| Molecular Formula | C18H13N3O6 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-4-(5-nitrofuran-2-yl)-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | COc1ccc(-c2cc(-c3ccc([N+](=O)[O-])o3)c(C#N)c(=O)[nH]2)cc1OC |
| InChI | InChI=1S/C18H13N3O6/c1-25-15-4-3-10(7-16(15)26-2)13-8-11(12(9-19)18(22)20-13)14-5-6-17(27-14)21(23)24/h3-8H,1-2H3,(H,20,22) |
| InChIKey | HTABJSCMJMPNDB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_E(4)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|