C21H14N2O2 — CID 133064841
4-(5-methylfuran-2-yl)-6-naphthalen-2-yl-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 133064841) has the molecular formula C21H14N2O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is 4-(5-methylfuran-2-yl)-6-naphthalen-2-yl-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 4-(5-methylfuran-2-yl)-6-naphthalen-2-yl-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133064841 |
| Molecular Formula | C21H14N2O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 4-(5-methylfuran-2-yl)-6-naphthalen-2-yl-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | Cc1ccc(-c2cc(-c3ccc4ccccc4c3)[nH]c(=O)c2C#N)o1 |
| InChI | InChI=1S/C21H14N2O2/c1-13-6-9-20(25-13)17-11-19(23-21(24)18(17)12-22)16-8-7-14-4-2-3-5-15(14)10-16/h2-11H,1H3,(H,23,24) |
| InChIKey | YRYNVZZVSAXUGG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_E(4)', 'substructure': 'N/A'} |
|---|