C18H13BrN2O2S — CID 19656683
4-(4-bromo-5-methylthiophen-2-yl)-6-(3-methoxyphenyl)-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 19656683) has the molecular formula C18H13BrN2O2S and a molecular weight of 401.29 g/mol. Its IUPAC name is 4-(4-bromo-5-methylthiophen-2-yl)-6-(3-methoxyphenyl)-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 4-(4-bromo-5-methylthiophen-2-yl)-6-(3-methoxyphenyl)-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19656683 |
| Molecular Formula | C18H13BrN2O2S |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 399.99 |
| IUPAC Name | 4-(4-bromo-5-methylthiophen-2-yl)-6-(3-methoxyphenyl)-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | COc1cccc(-c2cc(-c3cc(Br)c(C)s3)c(C#N)c(=O)[nH]2)c1 |
| InChI | InChI=1S/C18H13BrN2O2S/c1-10-15(19)8-17(24-10)13-7-16(21-18(22)14(13)9-20)11-4-3-5-12(6-11)23-2/h3-8H,1-2H3,(H,21,22) |
| InChIKey | LQZZTFGZEQEPCW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |