C23H22N2O2 — CID 19657125
4-(4-tert-butylphenyl)-6-(3-methoxyphenyl)-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 19657125) has the molecular formula C23H22N2O2 and a molecular weight of 358.44 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-6-(3-methoxyphenyl)-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 4-(4-tert-butylphenyl)-6-(3-methoxyphenyl)-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19657125 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 4-(4-tert-butylphenyl)-6-(3-methoxyphenyl)-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | COc1cccc(-c2cc(-c3ccc(C(C)(C)C)cc3)c(C#N)c(=O)[nH]2)c1 |
| InChI | InChI=1S/C23H22N2O2/c1-23(2,3)17-10-8-15(9-11-17)19-13-21(25-22(26)20(19)14-24)16-6-5-7-18(12-16)27-4/h5-13H,1-4H3,(H,25,26) |
| InChIKey | KLSJNHWRKVXKDC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |