C19H16N2O2S — CID 19656658
6-(4-ethoxyphenyl)-4-(5-methylthiophen-2-yl)-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 19656658) has the molecular formula C19H16N2O2S and a molecular weight of 336.42 g/mol. Its IUPAC name is 6-(4-ethoxyphenyl)-4-(5-methylthiophen-2-yl)-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 6-(4-ethoxyphenyl)-4-(5-methylthiophen-2-yl)-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19656658 |
| Molecular Formula | C19H16N2O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 6-(4-ethoxyphenyl)-4-(5-methylthiophen-2-yl)-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | CCOc1ccc(-c2cc(-c3ccc(C)s3)c(C#N)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C19H16N2O2S/c1-3-23-14-7-5-13(6-8-14)17-10-15(16(11-20)19(22)21-17)18-9-4-12(2)24-18/h4-10H,3H2,1-2H3,(H,21,22) |
| InChIKey | CJRZIMBPDDJKHC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |