C18H11F3N2OS — CID 19656861
6-(5-methylthiophen-2-yl)-2-oxo-4-[3-(trifluoromethyl)phenyl]-1H-pyridine-3-carbonitrile (PubChem CID 19656861) has the molecular formula C18H11F3N2OS and a molecular weight of 360.36 g/mol. Its IUPAC name is 6-(5-methylthiophen-2-yl)-2-oxo-4-[3-(trifluoromethyl)phenyl]-1H-pyridine-3-carbonitrile.
| Compound Name | 6-(5-methylthiophen-2-yl)-2-oxo-4-[3-(trifluoromethyl)phenyl]-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19656861 |
| Molecular Formula | C18H11F3N2OS |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 6-(5-methylthiophen-2-yl)-2-oxo-4-[3-(trifluoromethyl)phenyl]-1H-pyridine-3-carbonitrile |
| SMILES | Cc1ccc(-c2cc(-c3cccc(C(F)(F)F)c3)c(C#N)c(=O)[nH]2)s1 |
| InChI | InChI=1S/C18H11F3N2OS/c1-10-5-6-16(25-10)15-8-13(14(9-22)17(24)23-15)11-3-2-4-12(7-11)18(19,20)21/h2-8H,1H3,(H,23,24) |
| InChIKey | KYFONNQDOHBMQS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |