C17H9F3N2OS — CID 19656842
2-oxo-6-thiophen-2-yl-4-[3-(trifluoromethyl)phenyl]-1H-pyridine-3-carbonitrile (PubChem CID 19656842) has the molecular formula C17H9F3N2OS and a molecular weight of 346.33 g/mol. Its IUPAC name is 2-oxo-6-thiophen-2-yl-4-[3-(trifluoromethyl)phenyl]-1H-pyridine-3-carbonitrile.
| Compound Name | 2-oxo-6-thiophen-2-yl-4-[3-(trifluoromethyl)phenyl]-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19656842 |
| Molecular Formula | C17H9F3N2OS |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 2-oxo-6-thiophen-2-yl-4-[3-(trifluoromethyl)phenyl]-1H-pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2cccc(C(F)(F)F)c2)cc(-c2cccs2)[nH]c1=O |
| InChI | InChI=1S/C17H9F3N2OS/c18-17(19,20)11-4-1-3-10(7-11)12-8-14(15-5-2-6-24-15)22-16(23)13(12)9-21/h1-8H,(H,22,23) |
| InChIKey | KXWLTHNYYLTORH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |