C20H14BrClN2O2 — CID 168586657
4-[2-[(4-bromophenyl)methoxy]-5-chlorophenyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 168586657) has the molecular formula C20H14BrClN2O2 and a molecular weight of 429.70 g/mol. Its IUPAC name is 4-[2-[(4-bromophenyl)methoxy]-5-chlorophenyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 4-[2-[(4-bromophenyl)methoxy]-5-chlorophenyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168586657 |
| Molecular Formula | C20H14BrClN2O2 |
| Molecular Weight | 429.70 g/mol |
| Exact Mass | 427.99 |
| IUPAC Name | 4-[2-[(4-bromophenyl)methoxy]-5-chlorophenyl]-6-methyl-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | Cc1cc(-c2cc(Cl)ccc2OCc2ccc(Br)cc2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C20H14BrClN2O2/c1-12-8-16(18(10-23)20(25)24-12)17-9-15(22)6-7-19(17)26-11-13-2-4-14(21)5-3-13/h2-9H,11H2,1H3,(H,24,25) |
| InChIKey | JSGPVAGRAKMMGZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.70 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |