C17H15IN2O3 — CID 168586272
4-(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile (PubChem CID 168586272) has the molecular formula C17H15IN2O3 and a molecular weight of 422.22 g/mol. Its IUPAC name is 4-(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile.
| Compound Name | 4-(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168586272 |
| Molecular Formula | C17H15IN2O3 |
| Molecular Weight | 422.22 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | 4-(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)-6-methyl-2-oxo-1H-pyridine-3-carbonitrile |
| SMILES | C=CCOc1c(I)cc(-c2cc(C)[nH]c(=O)c2C#N)cc1OC |
| InChI | InChI=1S/C17H15IN2O3/c1-4-5-23-16-14(18)7-11(8-15(16)22-3)12-6-10(2)20-17(21)13(12)9-19/h4,6-8H,1,5H2,2-3H3,(H,20,21) |
| InChIKey | YULFQBOXYINFOY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.22 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|