C17H16IN3O3S — CID 168589244
4-(3-ethoxy-5-iodo-4-prop-2-enoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168589244) has the molecular formula C17H16IN3O3S and a molecular weight of 469.30 g/mol. Its IUPAC name is 4-(3-ethoxy-5-iodo-4-prop-2-enoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(3-ethoxy-5-iodo-4-prop-2-enoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168589244 |
| Molecular Formula | C17H16IN3O3S |
| Molecular Weight | 469.30 g/mol |
| Exact Mass | 469.00 |
| IUPAC Name | 4-(3-ethoxy-5-iodo-4-prop-2-enoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | C=CCOc1c(I)cc(-c2nc(SC)[nH]c(=O)c2C#N)cc1OCC |
| InChI | InChI=1S/C17H16IN3O3S/c1-4-6-24-15-12(18)7-10(8-13(15)23-5-2)14-11(9-19)16(22)21-17(20-14)25-3/h4,7-8H,1,5-6H2,2-3H3,(H,20,21,22) |
| InChIKey | FMFLFLPHNMIVGO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|