C14H14BN3O4S — CID 168590154
[3-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-5-ethoxyphenyl]boronic acid (PubChem CID 168590154) has the molecular formula C14H14BN3O4S and a molecular weight of 331.16 g/mol. Its IUPAC name is [3-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-5-ethoxyphenyl]boronic acid.
| Compound Name | [3-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-5-ethoxyphenyl]boronic acid |
|---|---|
| PubChem CID | 168590154 |
| Molecular Formula | C14H14BN3O4S |
| Molecular Weight | 331.16 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | [3-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-5-ethoxyphenyl]boronic acid |
| SMILES | CCOc1cc(B(O)O)cc(-c2nc(SC)[nH]c(=O)c2C#N)c1 |
| InChI | InChI=1S/C14H14BN3O4S/c1-3-22-10-5-8(4-9(6-10)15(20)21)12-11(7-16)13(19)18-14(17-12)23-2/h4-6,20-21H,3H2,1-2H3,(H,17,18,19) |
| InChIKey | PVVFQUPKKBGAGP-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.16 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|