C13H12BN3O3S — CID 168588207
[3-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-4-methylphenyl]boronic acid (PubChem CID 168588207) has the molecular formula C13H12BN3O3S and a molecular weight of 301.14 g/mol. Its IUPAC name is [3-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-4-methylphenyl]boronic acid.
| Compound Name | [3-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-4-methylphenyl]boronic acid |
|---|---|
| PubChem CID | 168588207 |
| Molecular Formula | C13H12BN3O3S |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | [3-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-4-methylphenyl]boronic acid |
| SMILES | CSc1nc(-c2cc(B(O)O)ccc2C)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C13H12BN3O3S/c1-7-3-4-8(14(19)20)5-9(7)11-10(6-15)12(18)17-13(16-11)21-2/h3-5,19-20H,1-2H3,(H,16,17,18) |
| InChIKey | PBZKAHMCZZIPAX-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|