C12H8ClN3O2S — CID 168588741
4-(2-chloro-4-hydroxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168588741) has the molecular formula C12H8ClN3O2S and a molecular weight of 293.74 g/mol. Its IUPAC name is 4-(2-chloro-4-hydroxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(2-chloro-4-hydroxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168588741 |
| Molecular Formula | C12H8ClN3O2S |
| Molecular Weight | 293.74 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 4-(2-chloro-4-hydroxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2ccc(O)cc2Cl)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C12H8ClN3O2S/c1-19-12-15-10(8(5-14)11(18)16-12)7-3-2-6(17)4-9(7)13/h2-4,17H,1H3,(H,15,16,18) |
| InChIKey | MOKSVOLZNSKRRD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.74 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|