C13H9Cl2N3O2S — CID 168590214
4-[2,6-dichloro-4-(hydroxymethyl)phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168590214) has the molecular formula C13H9Cl2N3O2S and a molecular weight of 342.21 g/mol. Its IUPAC name is 4-[2,6-dichloro-4-(hydroxymethyl)phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-[2,6-dichloro-4-(hydroxymethyl)phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168590214 |
| Molecular Formula | C13H9Cl2N3O2S |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | 4-[2,6-dichloro-4-(hydroxymethyl)phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2c(Cl)cc(CO)cc2Cl)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C13H9Cl2N3O2S/c1-21-13-17-11(7(4-16)12(20)18-13)10-8(14)2-6(5-19)3-9(10)15/h2-3,19H,5H2,1H3,(H,17,18,20) |
| InChIKey | ZNODIJWWPVCTHK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|