C16H18BN3O4S — CID 168590177
[3-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-5-methyl-2-propan-2-yloxyphenyl]boronic acid (PubChem CID 168590177) has the molecular formula C16H18BN3O4S and a molecular weight of 359.22 g/mol. Its IUPAC name is [3-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-5-methyl-2-propan-2-yloxyphenyl]boronic acid.
| Compound Name | [3-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-5-methyl-2-propan-2-yloxyphenyl]boronic acid |
|---|---|
| PubChem CID | 168590177 |
| Molecular Formula | C16H18BN3O4S |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | [3-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-5-methyl-2-propan-2-yloxyphenyl]boronic acid |
| SMILES | CSc1nc(-c2cc(C)cc(B(O)O)c2OC(C)C)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C16H18BN3O4S/c1-8(2)24-14-10(5-9(3)6-12(14)17(22)23)13-11(7-18)15(21)20-16(19-13)25-4/h5-6,8,22-23H,1-4H3,(H,19,20,21) |
| InChIKey | AXBXHCPLBZNHES-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|