C15H14BrN3O2S — CID 168588166
4-(2-bromo-5-propan-2-yloxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168588166) has the molecular formula C15H14BrN3O2S and a molecular weight of 380.27 g/mol. Its IUPAC name is 4-(2-bromo-5-propan-2-yloxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(2-bromo-5-propan-2-yloxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168588166 |
| Molecular Formula | C15H14BrN3O2S |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 4-(2-bromo-5-propan-2-yloxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2cc(OC(C)C)ccc2Br)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C15H14BrN3O2S/c1-8(2)21-9-4-5-12(16)10(6-9)13-11(7-17)14(20)19-15(18-13)22-3/h4-6,8H,1-3H3,(H,18,19,20) |
| InChIKey | AHQKBZFDJPBFLE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|