C15H14BrN3O4S — CID 168589054
4-(2-bromo-3,4,5-trimethoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168589054) has the molecular formula C15H14BrN3O4S and a molecular weight of 412.27 g/mol. Its IUPAC name is 4-(2-bromo-3,4,5-trimethoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(2-bromo-3,4,5-trimethoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168589054 |
| Molecular Formula | C15H14BrN3O4S |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | 4-(2-bromo-3,4,5-trimethoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | COc1cc(-c2nc(SC)[nH]c(=O)c2C#N)c(Br)c(OC)c1OC |
| InChI | InChI=1S/C15H14BrN3O4S/c1-21-9-5-7(10(16)13(23-3)12(9)22-2)11-8(6-17)14(20)19-15(18-11)24-4/h5H,1-4H3,(H,18,19,20) |
| InChIKey | LWXJGEHEVFXRJK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|