C16H15Br2N3O3S — CID 168589269
4-(2,3-dibromo-4,5-diethoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168589269) has the molecular formula C16H15Br2N3O3S and a molecular weight of 489.19 g/mol. Its IUPAC name is 4-(2,3-dibromo-4,5-diethoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(2,3-dibromo-4,5-diethoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168589269 |
| Molecular Formula | C16H15Br2N3O3S |
| Molecular Weight | 489.19 g/mol |
| Exact Mass | 486.92 |
| IUPAC Name | 4-(2,3-dibromo-4,5-diethoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CCOc1cc(-c2nc(SC)[nH]c(=O)c2C#N)c(Br)c(Br)c1OCC |
| InChI | InChI=1S/C16H15Br2N3O3S/c1-4-23-10-6-8(11(17)12(18)14(10)24-5-2)13-9(7-19)15(22)21-16(20-13)25-3/h6H,4-5H2,1-3H3,(H,20,21,22) |
| InChIKey | RKJHJVXBNYFOTQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.19 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|