C14H13N3O4S — CID 168587606
4-(2-hydroxy-3,5-dimethoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168587606) has the molecular formula C14H13N3O4S and a molecular weight of 319.34 g/mol. Its IUPAC name is 4-(2-hydroxy-3,5-dimethoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(2-hydroxy-3,5-dimethoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168587606 |
| Molecular Formula | C14H13N3O4S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 4-(2-hydroxy-3,5-dimethoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | COc1cc(OC)c(O)c(-c2nc(SC)[nH]c(=O)c2C#N)c1 |
| InChI | InChI=1S/C14H13N3O4S/c1-20-7-4-8(12(18)10(5-7)21-2)11-9(6-15)13(19)17-14(16-11)22-3/h4-5,18H,1-3H3,(H,16,17,19) |
| InChIKey | JQHPZUOYIYVODS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|