C13H9BrClN3O2S — CID 168589941
4-(3-bromo-5-chloro-4-methoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168589941) has the molecular formula C13H9BrClN3O2S and a molecular weight of 386.66 g/mol. Its IUPAC name is 4-(3-bromo-5-chloro-4-methoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(3-bromo-5-chloro-4-methoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168589941 |
| Molecular Formula | C13H9BrClN3O2S |
| Molecular Weight | 386.66 g/mol |
| Exact Mass | 384.93 |
| IUPAC Name | 4-(3-bromo-5-chloro-4-methoxyphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | COc1c(Cl)cc(-c2nc(SC)[nH]c(=O)c2C#N)cc1Br |
| InChI | InChI=1S/C13H9BrClN3O2S/c1-20-11-8(14)3-6(4-9(11)15)10-7(5-16)12(19)18-13(17-10)21-2/h3-4H,1-2H3,(H,17,18,19) |
| InChIKey | NCJDVIYEHQYLBM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.66 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|