C17H16ClN3O5S — CID 168589886
2-[2-chloro-4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-6-ethoxyphenoxy]propanoic acid (PubChem CID 168589886) has the molecular formula C17H16ClN3O5S and a molecular weight of 409.85 g/mol. Its IUPAC name is 2-[2-chloro-4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-6-ethoxyphenoxy]propanoic acid.
| Compound Name | 2-[2-chloro-4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-6-ethoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 168589886 |
| Molecular Formula | C17H16ClN3O5S |
| Molecular Weight | 409.85 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | 2-[2-chloro-4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-6-ethoxyphenoxy]propanoic acid |
| SMILES | CCOc1cc(-c2nc(SC)[nH]c(=O)c2C#N)cc(Cl)c1OC(C)C(=O)O |
| InChI | InChI=1S/C17H16ClN3O5S/c1-4-25-12-6-9(5-11(18)14(12)26-8(2)16(23)24)13-10(7-19)15(22)21-17(20-13)27-3/h5-6,8H,4H2,1-3H3,(H,23,24)(H,20,21,22) |
| InChIKey | HKLRLCOBVOXTMS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 125.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.85 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|