C17H17N3O4S — CID 168589820
[5-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-ethoxyphenyl]methyl acetate (PubChem CID 168589820) has the molecular formula C17H17N3O4S and a molecular weight of 359.41 g/mol. Its IUPAC name is [5-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-ethoxyphenyl]methyl acetate.
| Compound Name | [5-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-ethoxyphenyl]methyl acetate |
|---|---|
| PubChem CID | 168589820 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | [5-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-ethoxyphenyl]methyl acetate |
| SMILES | CCOc1ccc(-c2nc(SC)[nH]c(=O)c2C#N)cc1COC(C)=O |
| InChI | InChI=1S/C17H17N3O4S/c1-4-23-14-6-5-11(7-12(14)9-24-10(2)21)15-13(8-18)16(22)20-17(19-15)25-3/h5-7H,4,9H2,1-3H3,(H,19,20,22) |
| InChIKey | FEIUDWORMGACEP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|