C20H15N3O4S — CID 168590190
5-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-phenylmethoxybenzoic acid (PubChem CID 168590190) has the molecular formula C20H15N3O4S and a molecular weight of 393.42 g/mol. Its IUPAC name is 5-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-phenylmethoxybenzoic acid.
| Compound Name | 5-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-phenylmethoxybenzoic acid |
|---|---|
| PubChem CID | 168590190 |
| Molecular Formula | C20H15N3O4S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 5-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-phenylmethoxybenzoic acid |
| SMILES | CSc1nc(-c2ccc(OCc3ccccc3)c(C(=O)O)c2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C20H15N3O4S/c1-28-20-22-17(15(10-21)18(24)23-20)13-7-8-16(14(9-13)19(25)26)27-11-12-5-3-2-4-6-12/h2-9H,11H2,1H3,(H,25,26)(H,22,23,24) |
| InChIKey | INGMZEUMJWYUJA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|