C21H16F3N3O3S — CID 168589635
4-[4-methoxy-3-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168589635) has the molecular formula C21H16F3N3O3S and a molecular weight of 447.44 g/mol. Its IUPAC name is 4-[4-methoxy-3-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-[4-methoxy-3-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168589635 |
| Molecular Formula | C21H16F3N3O3S |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 4-[4-methoxy-3-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | COc1ccc(-c2nc(SC)[nH]c(=O)c2C#N)cc1OCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H16F3N3O3S/c1-29-16-7-6-13(18-15(10-25)19(28)27-20(26-18)31-2)9-17(16)30-11-12-4-3-5-14(8-12)21(22,23)24/h3-9H,11H2,1-2H3,(H,26,27,28) |
| InChIKey | OXWSKGOFZSKXAN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|