C21H19N3O6S — CID 168587523
methyl 5-[[4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-ethoxyphenoxy]methyl]furan-2-carboxylate (PubChem CID 168587523) has the molecular formula C21H19N3O6S and a molecular weight of 441.47 g/mol. Its IUPAC name is methyl 5-[[4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-ethoxyphenoxy]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-ethoxyphenoxy]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 168587523 |
| Molecular Formula | C21H19N3O6S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | methyl 5-[[4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-ethoxyphenoxy]methyl]furan-2-carboxylate |
| SMILES | CCOc1cc(-c2nc(SC)[nH]c(=O)c2C#N)ccc1OCc1ccc(C(=O)OC)o1 |
| InChI | InChI=1S/C21H19N3O6S/c1-4-28-17-9-12(18-14(10-22)19(25)24-21(23-18)31-3)5-7-15(17)29-11-13-6-8-16(30-13)20(26)27-2/h5-9H,4,11H2,1-3H3,(H,23,24,25) |
| InChIKey | ICLZOBBNNWUBLK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 127.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|