C23H20N4O6S — CID 168589144
methyl 2-[[2-[4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-methoxyphenoxy]acetyl]amino]benzoate (PubChem CID 168589144) has the molecular formula C23H20N4O6S and a molecular weight of 480.50 g/mol. Its IUPAC name is methyl 2-[[2-[4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-methoxyphenoxy]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-methoxyphenoxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 168589144 |
| Molecular Formula | C23H20N4O6S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | methyl 2-[[2-[4-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)-2-methoxyphenoxy]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)COc1ccc(-c2nc(SC)[nH]c(=O)c2C#N)cc1OC |
| InChI | InChI=1S/C23H20N4O6S/c1-31-18-10-13(20-15(11-24)21(29)27-23(26-20)34-3)8-9-17(18)33-12-19(28)25-16-7-5-4-6-14(16)22(30)32-2/h4-10H,12H2,1-3H3,(H,25,28)(H,26,27,29) |
| InChIKey | GUEVDWFKINBTIM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 143.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|