C16H13ClN8O3 — CID 169397019
2,4-diamino-6-[3-[(4-chloro-3-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]pyrimidine-5-carbonitrile (PubChem CID 169397019) has the molecular formula C16H13ClN8O3 and a molecular weight of 400.79 g/mol. Its IUPAC name is 2,4-diamino-6-[3-[(4-chloro-3-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-[3-[(4-chloro-3-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 169397019 |
| Molecular Formula | C16H13ClN8O3 |
| Molecular Weight | 400.79 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 2,4-diamino-6-[3-[(4-chloro-3-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]pyrimidine-5-carbonitrile |
| SMILES | COc1ccc(-c2nc(N)nc(N)c2C#N)cc1Cn1cc(Cl)c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C16H13ClN8O3/c1-28-12-3-2-8(13-10(5-18)14(19)22-16(20)21-13)4-9(12)6-24-7-11(17)15(23-24)25(26)27/h2-4,7H,6H2,1H3,(H4,19,20,21,22) |
| InChIKey | QASAMIVUCKHPMK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 171.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.79 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|