C16H19ClN4O5 — CID 170885327
ethyl 2-amino-3-[3-[(4-chloro-3-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]propanoate (PubChem CID 170885327) has the molecular formula C16H19ClN4O5 and a molecular weight of 382.80 g/mol. Its IUPAC name is ethyl 2-amino-3-[3-[(4-chloro-3-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]propanoate.
| Compound Name | ethyl 2-amino-3-[3-[(4-chloro-3-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]propanoate |
|---|---|
| PubChem CID | 170885327 |
| Molecular Formula | C16H19ClN4O5 |
| Molecular Weight | 382.80 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | ethyl 2-amino-3-[3-[(4-chloro-3-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]propanoate |
| SMILES | CCOC(=O)C(N)Cc1ccc(OC)c(Cn2cc(Cl)c([N+](=O)[O-])n2)c1 |
| InChI | InChI=1S/C16H19ClN4O5/c1-3-26-16(22)13(18)7-10-4-5-14(25-2)11(6-10)8-20-9-12(17)15(19-20)21(23)24/h4-6,9,13H,3,7-8,18H2,1-2H3 |
| InChIKey | VWECISNXFZZVGK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.80 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|