C13H13ClN6O4 — CID 168533100
[[4-[(4-chloro-3-nitropyrazol-1-yl)methyl]-3-methoxyphenyl]methylideneamino]urea (PubChem CID 168533100) has the molecular formula C13H13ClN6O4 and a molecular weight of 352.74 g/mol. Its IUPAC name is [[4-[(4-chloro-3-nitropyrazol-1-yl)methyl]-3-methoxyphenyl]methylideneamino]urea.
| Compound Name | [[4-[(4-chloro-3-nitropyrazol-1-yl)methyl]-3-methoxyphenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 168533100 |
| Molecular Formula | C13H13ClN6O4 |
| Molecular Weight | 352.74 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | [[4-[(4-chloro-3-nitropyrazol-1-yl)methyl]-3-methoxyphenyl]methylideneamino]urea |
| SMILES | COc1cc(C=NNC(N)=O)ccc1Cn1cc(Cl)c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C13H13ClN6O4/c1-24-11-4-8(5-16-17-13(15)21)2-3-9(11)6-19-7-10(14)12(18-19)20(22)23/h2-5,7H,6H2,1H3,(H3,15,17,21) |
| InChIKey | JRAAOJYZUTXOAS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.74 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|