C14H12ClN7O4 — CID 169403799
5-[4-[(4-chloro-3-nitropyrazol-1-yl)methyl]-3-methoxyphenyl]-2H-triazole-4-carboxamide (PubChem CID 169403799) has the molecular formula C14H12ClN7O4 and a molecular weight of 377.75 g/mol. Its IUPAC name is 5-[4-[(4-chloro-3-nitropyrazol-1-yl)methyl]-3-methoxyphenyl]-2H-triazole-4-carboxamide.
| Compound Name | 5-[4-[(4-chloro-3-nitropyrazol-1-yl)methyl]-3-methoxyphenyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 169403799 |
| Molecular Formula | C14H12ClN7O4 |
| Molecular Weight | 377.75 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 5-[4-[(4-chloro-3-nitropyrazol-1-yl)methyl]-3-methoxyphenyl]-2H-triazole-4-carboxamide |
| SMILES | COc1cc(-c2n[nH]nc2C(N)=O)ccc1Cn1cc(Cl)c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C14H12ClN7O4/c1-26-10-4-7(11-12(13(16)23)18-20-17-11)2-3-8(10)5-21-6-9(15)14(19-21)22(24)25/h2-4,6H,5H2,1H3,(H2,16,23)(H,17,18,20) |
| InChIKey | CHAPJSMWVSUUKF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 154.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.75 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|