C13H13ClN6O3S — CID 168534904
[[3-[(4-chloro-3-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]thiourea (PubChem CID 168534904) has the molecular formula C13H13ClN6O3S and a molecular weight of 368.81 g/mol. Its IUPAC name is [[3-[(4-chloro-3-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]thiourea.
| Compound Name | [[3-[(4-chloro-3-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 168534904 |
| Molecular Formula | C13H13ClN6O3S |
| Molecular Weight | 368.81 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | [[3-[(4-chloro-3-nitropyrazol-1-yl)methyl]-4-methoxyphenyl]methylideneamino]thiourea |
| SMILES | COc1ccc(C=NNC(N)=S)cc1Cn1cc(Cl)c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C13H13ClN6O3S/c1-23-11-3-2-8(5-16-17-13(15)24)4-9(11)6-19-7-10(14)12(18-19)20(21)22/h2-5,7H,6H2,1H3,(H3,15,17,24) |
| InChIKey | GMYMQZBFFMCNNC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.81 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|