C15H18N6O3S — CID 28896229
1-ethyl-3-[(Z)-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]methylideneamino]thiourea (PubChem CID 28896229) has the molecular formula C15H18N6O3S and a molecular weight of 362.42 g/mol. Its IUPAC name is 1-ethyl-3-[(Z)-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]methylideneamino]thiourea.
| Compound Name | 1-ethyl-3-[(Z)-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 28896229 |
| Molecular Formula | C15H18N6O3S |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 1-ethyl-3-[(Z)-[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]methylideneamino]thiourea |
| SMILES | CCNC(=S)N/N=C\c1ccc(OC)c(Cn2cc([N+](=O)[O-])cn2)c1 |
| InChI | InChI=1S/C15H18N6O3S/c1-3-16-15(25)19-17-7-11-4-5-14(24-2)12(6-11)9-20-10-13(8-18-20)21(22)23/h4-8,10H,3,9H2,1-2H3,(H2,16,19,25)/b17-7- |
| InChIKey | WUQHXHZHQLBOBJ-IDUWFGFVSA-N |
| XLogP | 1.67 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|