C13H14N6O4 — CID 168532467
[[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]methylideneamino]urea (PubChem CID 168532467) has the molecular formula C13H14N6O4 and a molecular weight of 318.29 g/mol. Its IUPAC name is [[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]methylideneamino]urea.
| Compound Name | [[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 168532467 |
| Molecular Formula | C13H14N6O4 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | [[4-methoxy-3-[(4-nitropyrazol-1-yl)methyl]phenyl]methylideneamino]urea |
| SMILES | COc1ccc(C=NNC(N)=O)cc1Cn1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C13H14N6O4/c1-23-12-3-2-9(5-15-17-13(14)20)4-10(12)7-18-8-11(6-16-18)19(21)22/h2-6,8H,7H2,1H3,(H3,14,17,20) |
| InChIKey | YVBDBZIWDQWVKT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|