C20H24ClNO4 — CID 170885623
ethyl 2-amino-3-[3-[(2-chloro-4-methylphenoxy)methyl]-4-methoxyphenyl]propanoate (PubChem CID 170885623) has the molecular formula C20H24ClNO4 and a molecular weight of 377.87 g/mol. Its IUPAC name is ethyl 2-amino-3-[3-[(2-chloro-4-methylphenoxy)methyl]-4-methoxyphenyl]propanoate.
| Compound Name | ethyl 2-amino-3-[3-[(2-chloro-4-methylphenoxy)methyl]-4-methoxyphenyl]propanoate |
|---|---|
| PubChem CID | 170885623 |
| Molecular Formula | C20H24ClNO4 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | ethyl 2-amino-3-[3-[(2-chloro-4-methylphenoxy)methyl]-4-methoxyphenyl]propanoate |
| SMILES | CCOC(=O)C(N)Cc1ccc(OC)c(COc2ccc(C)cc2Cl)c1 |
| InChI | InChI=1S/C20H24ClNO4/c1-4-25-20(23)17(22)11-14-6-8-18(24-3)15(10-14)12-26-19-7-5-13(2)9-16(19)21/h5-10,17H,4,11-12,22H2,1-3H3 |
| InChIKey | CKQRJJIMHPNRHE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |