C18H11N5O6S — CID 168589223
4-[2-(2,4-dinitrophenoxy)phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168589223) has the molecular formula C18H11N5O6S and a molecular weight of 425.38 g/mol. Its IUPAC name is 4-[2-(2,4-dinitrophenoxy)phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-[2-(2,4-dinitrophenoxy)phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168589223 |
| Molecular Formula | C18H11N5O6S |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | 4-[2-(2,4-dinitrophenoxy)phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2ccccc2Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C18H11N5O6S/c1-30-18-20-16(12(9-19)17(24)21-18)11-4-2-3-5-14(11)29-15-7-6-10(22(25)26)8-13(15)23(27)28/h2-8H,1H3,(H,20,21,24) |
| InChIKey | LZWFOGIHKSDXMH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 165.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|