C13H8F2N4O4S — CID 168588589
4-[2-(difluoromethoxy)-5-nitrophenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168588589) has the molecular formula C13H8F2N4O4S and a molecular weight of 354.29 g/mol. Its IUPAC name is 4-[2-(difluoromethoxy)-5-nitrophenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-[2-(difluoromethoxy)-5-nitrophenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168588589 |
| Molecular Formula | C13H8F2N4O4S |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 4-[2-(difluoromethoxy)-5-nitrophenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2cc([N+](=O)[O-])ccc2OC(F)F)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C13H8F2N4O4S/c1-24-13-17-10(8(5-16)11(20)18-13)7-4-6(19(21)22)2-3-9(7)23-12(14)15/h2-4,12H,1H3,(H,17,18,20) |
| InChIKey | FGQNQFXVTUHIKP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 121.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|