C9H7N2O6S- — CID 7201030
2-(2-methyl-3,5-dinitrophenyl)sulfanylacetate (PubChem CID 7201030) has the molecular formula C9H7N2O6S- and a molecular weight of 271.23 g/mol. Its IUPAC name is 2-(2-methyl-3,5-dinitrophenyl)sulfanylacetate.
| Compound Name | 2-(2-methyl-3,5-dinitrophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 7201030 |
| Molecular Formula | C9H7N2O6S- |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 2-(2-methyl-3,5-dinitrophenyl)sulfanylacetate |
| SMILES | Cc1c(SCC(=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H8N2O6S/c1-5-7(11(16)17)2-6(10(14)15)3-8(5)18-4-9(12)13/h2-3H,4H2,1H3,(H,12,13)/p-1 |
| InChIKey | JBWGOXOYDSMVJV-UHFFFAOYSA-M |
| XLogP | 0.65 |
| TPSA | 126.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|